C13H16F3NO — CID 115854106
2-cyclopropyl-1-[3-(trifluoromethoxy)phenyl]propan-1-amine (PubChem CID 115854106) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is 2-cyclopropyl-1-[3-(trifluoromethoxy)phenyl]propan-1-amine.
| Compound Name | 2-cyclopropyl-1-[3-(trifluoromethoxy)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 115854106 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-cyclopropyl-1-[3-(trifluoromethoxy)phenyl]propan-1-amine |
| SMILES | CC(C1CC1)C(N)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO/c1-8(9-5-6-9)12(17)10-3-2-4-11(7-10)18-13(14,15)16/h2-4,7-9,12H,5-6,17H2,1H3 |
| InChIKey | XMFODJRDJCKHFQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |