C14H31N — CID 115854187
N-ethyl-2,2,5,6,6-pentamethylheptan-3-amine (PubChem CID 115854187) has the molecular formula C14H31N and a molecular weight of 213.41 g/mol. Its IUPAC name is N-ethyl-2,2,5,6,6-pentamethylheptan-3-amine.
| Compound Name | N-ethyl-2,2,5,6,6-pentamethylheptan-3-amine |
|---|---|
| PubChem CID | 115854187 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | N-ethyl-2,2,5,6,6-pentamethylheptan-3-amine |
| SMILES | CCNC(CC(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H31N/c1-9-15-12(14(6,7)8)10-11(2)13(3,4)5/h11-12,15H,9-10H2,1-8H3 |
| InChIKey | KSFIZVUEWMBBAX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |