C15H17N3O3S2 — CID 1158565
4-piperidin-1-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 1158565) has the molecular formula C15H17N3O3S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-piperidin-1-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-piperidin-1-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 1158565 |
| Molecular Formula | C15H17N3O3S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 4-piperidin-1-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C15H17N3O3S2/c19-14(17-15-16-8-11-22-15)12-4-6-13(7-5-12)23(20,21)18-9-2-1-3-10-18/h4-8,11H,1-3,9-10H2,(H,16,17,19) |
| InChIKey | VTRLQKGWRUUERL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |