C12H12N2O3S2 — CID 2549893
4-methylsulfonyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 2549893) has the molecular formula C12H12N2O3S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-methylsulfonyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-methylsulfonyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 2549893 |
| Molecular Formula | C12H12N2O3S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 4-methylsulfonyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1csc(NC(=O)c2ccc(S(C)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C12H12N2O3S2/c1-8-7-18-12(13-8)14-11(15)9-3-5-10(6-4-9)19(2,16)17/h3-7H,1-2H3,(H,13,14,15) |
| InChIKey | ZQNBHCCCWOPFRJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |