C17H23NO2S — CID 115856968
1-(3,4-diethoxyphenyl)-3-thiophen-3-ylpropan-1-amine (PubChem CID 115856968) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)-3-thiophen-3-ylpropan-1-amine.
| Compound Name | 1-(3,4-diethoxyphenyl)-3-thiophen-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 115856968 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)-3-thiophen-3-ylpropan-1-amine |
| SMILES | CCOc1ccc(C(N)CCc2ccsc2)cc1OCC |
| InChI | InChI=1S/C17H23NO2S/c1-3-19-16-8-6-14(11-17(16)20-4-2)15(18)7-5-13-9-10-21-12-13/h6,8-12,15H,3-5,7,18H2,1-2H3 |
| InChIKey | DKUJXWRXGYYMET-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |