C11H10ClF2N3 — CID 115858401
(4-chloro-2,5-difluorophenyl)-(2-methylpyrazol-3-yl)methanamine (PubChem CID 115858401) has the molecular formula C11H10ClF2N3 and a molecular weight of 257.67 g/mol. Its IUPAC name is (4-chloro-2,5-difluorophenyl)-(2-methylpyrazol-3-yl)methanamine.
| Compound Name | (4-chloro-2,5-difluorophenyl)-(2-methylpyrazol-3-yl)methanamine |
|---|---|
| PubChem CID | 115858401 |
| Molecular Formula | C11H10ClF2N3 |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | (4-chloro-2,5-difluorophenyl)-(2-methylpyrazol-3-yl)methanamine |
| SMILES | Cn1nccc1C(N)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C11H10ClF2N3/c1-17-10(2-3-16-17)11(15)6-4-9(14)7(12)5-8(6)13/h2-5,11H,15H2,1H3 |
| InChIKey | HXTMCFACWMBRIK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|