C11H11F2N3 — CID 63963313
(3,5-difluorophenyl)-(2-methylpyrazol-3-yl)methanamine (PubChem CID 63963313) has the molecular formula C11H11F2N3 and a molecular weight of 223.23 g/mol. Its IUPAC name is (3,5-difluorophenyl)-(2-methylpyrazol-3-yl)methanamine.
| Compound Name | (3,5-difluorophenyl)-(2-methylpyrazol-3-yl)methanamine |
|---|---|
| PubChem CID | 63963313 |
| Molecular Formula | C11H11F2N3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | (3,5-difluorophenyl)-(2-methylpyrazol-3-yl)methanamine |
| SMILES | Cn1nccc1C(N)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H11F2N3/c1-16-10(2-3-15-16)11(14)7-4-8(12)6-9(13)5-7/h2-6,11H,14H2,1H3 |
| InChIKey | KKUOPWXYUOGRLN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |