C13H25N3 — CID 115860166
1-(1-ethylimidazol-2-yl)-3,4,4-trimethylpentan-1-amine (PubChem CID 115860166) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 1-(1-ethylimidazol-2-yl)-3,4,4-trimethylpentan-1-amine.
| Compound Name | 1-(1-ethylimidazol-2-yl)-3,4,4-trimethylpentan-1-amine |
|---|---|
| PubChem CID | 115860166 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 1-(1-ethylimidazol-2-yl)-3,4,4-trimethylpentan-1-amine |
| SMILES | CCn1ccnc1C(N)CC(C)C(C)(C)C |
| InChI | InChI=1S/C13H25N3/c1-6-16-8-7-15-12(16)11(14)9-10(2)13(3,4)5/h7-8,10-11H,6,9,14H2,1-5H3 |
| InChIKey | FPJUNMWLKIDLDY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |