C11H20N2O2 — CID 103457324
1-(1-ethylimidazol-2-yl)-3,3-dimethylbutane-1,2-diol (PubChem CID 103457324) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 1-(1-ethylimidazol-2-yl)-3,3-dimethylbutane-1,2-diol.
| Compound Name | 1-(1-ethylimidazol-2-yl)-3,3-dimethylbutane-1,2-diol |
|---|---|
| PubChem CID | 103457324 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 1-(1-ethylimidazol-2-yl)-3,3-dimethylbutane-1,2-diol |
| SMILES | CCn1ccnc1C(O)C(O)C(C)(C)C |
| InChI | InChI=1S/C11H20N2O2/c1-5-13-7-6-12-10(13)8(14)9(15)11(2,3)4/h6-9,14-15H,5H2,1-4H3 |
| InChIKey | HXLMOXZKGNSPLL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |