C8H13N3O3 — CID 171869595
3-(1-ethylimidazol-2-yl)-2,3-dihydroxypropanamide (PubChem CID 171869595) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 3-(1-ethylimidazol-2-yl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(1-ethylimidazol-2-yl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171869595 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 3-(1-ethylimidazol-2-yl)-2,3-dihydroxypropanamide |
| SMILES | CCn1ccnc1C(O)C(O)C(N)=O |
| InChI | InChI=1S/C8H13N3O3/c1-2-11-4-3-10-8(11)6(13)5(12)7(9)14/h3-6,12-13H,2H2,1H3,(H2,9,14) |
| InChIKey | IYFSRWAMPLNRFP-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |