C15H27N3 — CID 115860523
N-ethyl-3,5,5-trimethyl-1-pyrazin-2-ylhexan-1-amine (PubChem CID 115860523) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is N-ethyl-3,5,5-trimethyl-1-pyrazin-2-ylhexan-1-amine.
| Compound Name | N-ethyl-3,5,5-trimethyl-1-pyrazin-2-ylhexan-1-amine |
|---|---|
| PubChem CID | 115860523 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | N-ethyl-3,5,5-trimethyl-1-pyrazin-2-ylhexan-1-amine |
| SMILES | CCNC(CC(C)CC(C)(C)C)c1cnccn1 |
| InChI | InChI=1S/C15H27N3/c1-6-17-13(14-11-16-7-8-18-14)9-12(2)10-15(3,4)5/h7-8,11-13,17H,6,9-10H2,1-5H3 |
| InChIKey | DEZFLRCYQNAQNG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |