C13H24N4 — CID 79087147
N,N',N'-triethyl-1-pyrazin-2-ylpropane-1,3-diamine (PubChem CID 79087147) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is N,N',N'-triethyl-1-pyrazin-2-ylpropane-1,3-diamine.
| Compound Name | N,N',N'-triethyl-1-pyrazin-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 79087147 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | N,N',N'-triethyl-1-pyrazin-2-ylpropane-1,3-diamine |
| SMILES | CCNC(CCN(CC)CC)c1cnccn1 |
| InChI | InChI=1S/C13H24N4/c1-4-15-12(7-10-17(5-2)6-3)13-11-14-8-9-16-13/h8-9,11-12,15H,4-7,10H2,1-3H3 |
| InChIKey | CCACBWFSPDXJOO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |