C13H21NS — CID 115860707
1-(1-methylcyclopentyl)-3-thiophen-2-ylpropan-1-amine (PubChem CID 115860707) has the molecular formula C13H21NS and a molecular weight of 223.38 g/mol. Its IUPAC name is 1-(1-methylcyclopentyl)-3-thiophen-2-ylpropan-1-amine.
| Compound Name | 1-(1-methylcyclopentyl)-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 115860707 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 1-(1-methylcyclopentyl)-3-thiophen-2-ylpropan-1-amine |
| SMILES | CC1(C(N)CCc2cccs2)CCCC1 |
| InChI | InChI=1S/C13H21NS/c1-13(8-2-3-9-13)12(14)7-6-11-5-4-10-15-11/h4-5,10,12H,2-3,6-9,14H2,1H3 |
| InChIKey | QDHNKYAOQLNKAT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |