C10H8N4S — CID 11586565
N-(1H-benzimidazol-2-yl)-1,3-thiazol-2-amine (PubChem CID 11586565) has the molecular formula C10H8N4S and a molecular weight of 216.27 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-yl)-1,3-thiazol-2-amine.
| Compound Name | N-(1H-benzimidazol-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 11586565 |
| Molecular Formula | C10H8N4S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | N-(1H-benzimidazol-2-yl)-1,3-thiazol-2-amine |
| SMILES | c1ccc2[nH]c(Nc3nccs3)nc2c1 |
| InChI | InChI=1S/C10H8N4S/c1-2-4-8-7(3-1)12-9(13-8)14-10-11-5-6-15-10/h1-6H,(H2,11,12,13,14) |
| InChIKey | DDMZUSPZBMCBRS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |