C11H9N3S — CID 612049
4-(1-methylbenzimidazol-2-yl)-1,3-thiazole (PubChem CID 612049) has the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. Its IUPAC name is 4-(1-methylbenzimidazol-2-yl)-1,3-thiazole.
| Compound Name | 4-(1-methylbenzimidazol-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 612049 |
| Molecular Formula | C11H9N3S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 4-(1-methylbenzimidazol-2-yl)-1,3-thiazole |
| SMILES | Cn1c(-c2cscn2)nc2ccccc21 |
| InChI | InChI=1S/C11H9N3S/c1-14-10-5-3-2-4-8(10)13-11(14)9-6-15-7-12-9/h2-7H,1H3 |
| InChIKey | CSAHSZPPHOXJAP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |