C16H15FN6S2 — CID 11850833
9-butyl-8-[(7-fluoro-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine (PubChem CID 11850833) has the molecular formula C16H15FN6S2 and a molecular weight of 374.47 g/mol. Its IUPAC name is 9-butyl-8-[(7-fluoro-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine.
| Compound Name | 9-butyl-8-[(7-fluoro-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine |
|---|---|
| PubChem CID | 11850833 |
| Molecular Formula | C16H15FN6S2 |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 9-butyl-8-[(7-fluoro-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine |
| SMILES | CCCCn1c(Sc2nc3cccc(F)c3s2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C16H15FN6S2/c1-2-3-7-23-14-11(13(18)19-8-20-14)22-15(23)25-16-21-10-6-4-5-9(17)12(10)24-16/h4-6,8H,2-3,7H2,1H3,(H2,18,19,20) |
| InChIKey | UFONZWQOAQHFBD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |