C13H19NO — CID 115865979
2-cyclopropyl-N-[(E)-3-(furan-2-yl)prop-2-enyl]propan-1-amine (PubChem CID 115865979) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(E)-3-(furan-2-yl)prop-2-enyl]propan-1-amine.
| Compound Name | 2-cyclopropyl-N-[(E)-3-(furan-2-yl)prop-2-enyl]propan-1-amine |
|---|---|
| PubChem CID | 115865979 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 2-cyclopropyl-N-[(E)-3-(furan-2-yl)prop-2-enyl]propan-1-amine |
| SMILES | CC(CNC/C=C/c1ccco1)C1CC1 |
| InChI | InChI=1S/C13H19NO/c1-11(12-6-7-12)10-14-8-2-4-13-5-3-9-15-13/h2-5,9,11-12,14H,6-8,10H2,1H3/b4-2+ |
| InChIKey | HPZVVYFYRGCGPD-DUXPYHPUSA-N |
| XLogP | 2.93 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|