C12H17NO — CID 115865985
(E)-N-(cyclobutylmethyl)-3-(furan-2-yl)prop-2-en-1-amine (PubChem CID 115865985) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (E)-N-(cyclobutylmethyl)-3-(furan-2-yl)prop-2-en-1-amine.
| Compound Name | (E)-N-(cyclobutylmethyl)-3-(furan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 115865985 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (E)-N-(cyclobutylmethyl)-3-(furan-2-yl)prop-2-en-1-amine |
| SMILES | C(=C/c1ccco1)\CNCC1CCC1 |
| InChI | InChI=1S/C12H17NO/c1-4-11(5-1)10-13-8-2-6-12-7-3-9-14-12/h2-3,6-7,9,11,13H,1,4-5,8,10H2/b6-2+ |
| InChIKey | ATYQVILTSKGTSO-QHHAFSJGSA-N |
| XLogP | 2.68 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|