C9H17F2NO2 — CID 115868923
4-[[2,2-difluoroethyl(methyl)amino]methyl]oxan-4-ol (PubChem CID 115868923) has the molecular formula C9H17F2NO2 and a molecular weight of 209.24 g/mol. Its IUPAC name is 4-[[2,2-difluoroethyl(methyl)amino]methyl]oxan-4-ol.
| Compound Name | 4-[[2,2-difluoroethyl(methyl)amino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 115868923 |
| Molecular Formula | C9H17F2NO2 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 4-[[2,2-difluoroethyl(methyl)amino]methyl]oxan-4-ol |
| SMILES | CN(CC(F)F)CC1(O)CCOCC1 |
| InChI | InChI=1S/C9H17F2NO2/c1-12(6-8(10)11)7-9(13)2-4-14-5-3-9/h8,13H,2-7H2,1H3 |
| InChIKey | ZNFDOTLNCJXDQD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |