C12H11NO3 — CID 115870248
N-(furan-3-ylmethyl)-4-hydroxybenzamide (PubChem CID 115870248) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-4-hydroxybenzamide.
| Compound Name | N-(furan-3-ylmethyl)-4-hydroxybenzamide |
|---|---|
| PubChem CID | 115870248 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | N-(furan-3-ylmethyl)-4-hydroxybenzamide |
| SMILES | O=C(NCc1ccoc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H11NO3/c14-11-3-1-10(2-4-11)12(15)13-7-9-5-6-16-8-9/h1-6,8,14H,7H2,(H,13,15) |
| InChIKey | DYSJUNZCSGHWFF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |