C19H15ClFNO3 — CID 145364548
4-[(4-chloro-3-fluorophenyl)methoxy]-N-(furan-3-ylmethyl)benzamide (PubChem CID 145364548) has the molecular formula C19H15ClFNO3 and a molecular weight of 359.78 g/mol. Its IUPAC name is 4-[(4-chloro-3-fluorophenyl)methoxy]-N-(furan-3-ylmethyl)benzamide.
| Compound Name | 4-[(4-chloro-3-fluorophenyl)methoxy]-N-(furan-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 145364548 |
| Molecular Formula | C19H15ClFNO3 |
| Molecular Weight | 359.78 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 4-[(4-chloro-3-fluorophenyl)methoxy]-N-(furan-3-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccoc1)c1ccc(OCc2ccc(Cl)c(F)c2)cc1 |
| InChI | InChI=1S/C19H15ClFNO3/c20-17-6-1-13(9-18(17)21)12-25-16-4-2-15(3-5-16)19(23)22-10-14-7-8-24-11-14/h1-9,11H,10,12H2,(H,22,23) |
| InChIKey | HQFCDYPAWLTHOP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.78 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |