C8H16N2O2 — CID 115872031
3-hydroxy-N,3-dimethylpiperidine-1-carboxamide (PubChem CID 115872031) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 3-hydroxy-N,3-dimethylpiperidine-1-carboxamide.
| Compound Name | 3-hydroxy-N,3-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 115872031 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 3-hydroxy-N,3-dimethylpiperidine-1-carboxamide |
| SMILES | CNC(=O)N1CCCC(C)(O)C1 |
| InChI | InChI=1S/C8H16N2O2/c1-8(12)4-3-5-10(6-8)7(11)9-2/h12H,3-6H2,1-2H3,(H,9,11) |
| InChIKey | CAMSSKRYRURFFF-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |