C10H11FN2O2 — CID 115877668
6-fluoro-N-[1-(hydroxymethyl)cyclopropyl]pyridine-3-carboxamide (PubChem CID 115877668) has the molecular formula C10H11FN2O2 and a molecular weight of 210.21 g/mol. Its IUPAC name is 6-fluoro-N-[1-(hydroxymethyl)cyclopropyl]pyridine-3-carboxamide.
| Compound Name | 6-fluoro-N-[1-(hydroxymethyl)cyclopropyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 115877668 |
| Molecular Formula | C10H11FN2O2 |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 6-fluoro-N-[1-(hydroxymethyl)cyclopropyl]pyridine-3-carboxamide |
| SMILES | O=C(NC1(CO)CC1)c1ccc(F)nc1 |
| InChI | InChI=1S/C10H11FN2O2/c11-8-2-1-7(5-12-8)9(15)13-10(6-14)3-4-10/h1-2,5,14H,3-4,6H2,(H,13,15) |
| InChIKey | OTRGBRRPXWOWFS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|