C11H18N2O — CID 115879655
[1-(1H-pyrrol-3-ylmethyl)piperidin-2-yl]methanol (PubChem CID 115879655) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is [1-(1H-pyrrol-3-ylmethyl)piperidin-2-yl]methanol.
| Compound Name | [1-(1H-pyrrol-3-ylmethyl)piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 115879655 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | [1-(1H-pyrrol-3-ylmethyl)piperidin-2-yl]methanol |
| SMILES | OCC1CCCCN1Cc1cc[nH]c1 |
| InChI | InChI=1S/C11H18N2O/c14-9-11-3-1-2-6-13(11)8-10-4-5-12-7-10/h4-5,7,11-12,14H,1-3,6,8-9H2 |
| InChIKey | ZXZTZKLFZMGNJG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |