C10H16N2O — CID 115882282
[1-(1H-pyrrol-3-ylmethyl)pyrrolidin-2-yl]methanol (PubChem CID 115882282) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is [1-(1H-pyrrol-3-ylmethyl)pyrrolidin-2-yl]methanol.
| Compound Name | [1-(1H-pyrrol-3-ylmethyl)pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 115882282 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | [1-(1H-pyrrol-3-ylmethyl)pyrrolidin-2-yl]methanol |
| SMILES | OCC1CCCN1Cc1cc[nH]c1 |
| InChI | InChI=1S/C10H16N2O/c13-8-10-2-1-5-12(10)7-9-3-4-11-6-9/h3-4,6,10-11,13H,1-2,5,7-8H2 |
| InChIKey | BSGLAMKJMFSKTO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |