C12H19NO2 — CID 115879804
[5-[[ethyl(2-methylprop-2-enyl)amino]methyl]furan-2-yl]methanol (PubChem CID 115879804) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is [5-[[ethyl(2-methylprop-2-enyl)amino]methyl]furan-2-yl]methanol.
| Compound Name | [5-[[ethyl(2-methylprop-2-enyl)amino]methyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 115879804 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | [5-[[ethyl(2-methylprop-2-enyl)amino]methyl]furan-2-yl]methanol |
| SMILES | C=C(C)CN(CC)Cc1ccc(CO)o1 |
| InChI | InChI=1S/C12H19NO2/c1-4-13(7-10(2)3)8-11-5-6-12(9-14)15-11/h5-6,14H,2,4,7-9H2,1,3H3 |
| InChIKey | QDDSIOKMWBUJQU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|