C15H24N2 — CID 3817840
4-[[ethyl(2-methylprop-2-enyl)amino]methyl]-N,N-dimethylaniline (PubChem CID 3817840) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 4-[[ethyl(2-methylprop-2-enyl)amino]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[ethyl(2-methylprop-2-enyl)amino]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 3817840 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 4-[[ethyl(2-methylprop-2-enyl)amino]methyl]-N,N-dimethylaniline |
| SMILES | C=C(C)CN(CC)Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C15H24N2/c1-6-17(11-13(2)3)12-14-7-9-15(10-8-14)16(4)5/h7-10H,2,6,11-12H2,1,3-5H3 |
| InChIKey | XYCFFDHMHMNJLK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|