C17H26N2O5 — CID 11588107
(4aR,6S,7S,8S,8aS)-8-(3-aminopropylamino)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 11588107) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is (4aR,6S,7S,8S,8aS)-8-(3-aminopropylamino)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (4aR,6S,7S,8S,8aS)-8-(3-aminopropylamino)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 11588107 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (4aR,6S,7S,8S,8aS)-8-(3-aminopropylamino)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@@H](NCCCN)[C@@H]1O |
| InChI | InChI=1S/C17H26N2O5/c1-21-17-14(20)13(19-9-5-8-18)15-12(23-17)10-22-16(24-15)11-6-3-2-4-7-11/h2-4,6-7,12-17,19-20H,5,8-10,18H2,1H3/t12-,13+,14+,15-,16?,17+/m1/s1 |
| InChIKey | XVGBDKSWKISROY-LZDIORBQSA-N |
| XLogP | 0.14 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|