C21H31NO7 — CID 11395734
(2R,4aR,6S,7S,8R,8aS)-6-methoxy-7-[3-(2-methyl-1,3-dioxolan-2-yl)propylamino]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 11395734) has the molecular formula C21H31NO7 and a molecular weight of 409.48 g/mol. Its IUPAC name is (2R,4aR,6S,7S,8R,8aS)-6-methoxy-7-[3-(2-methyl-1,3-dioxolan-2-yl)propylamino]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (2R,4aR,6S,7S,8R,8aS)-6-methoxy-7-[3-(2-methyl-1,3-dioxolan-2-yl)propylamino]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 11395734 |
| Molecular Formula | C21H31NO7 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (2R,4aR,6S,7S,8R,8aS)-6-methoxy-7-[3-(2-methyl-1,3-dioxolan-2-yl)propylamino]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](O)[C@@H]1NCCCC1(C)OCCO1 |
| InChI | InChI=1S/C21H31NO7/c1-21(26-11-12-27-21)9-6-10-22-16-17(23)18-15(28-20(16)24-2)13-25-19(29-18)14-7-4-3-5-8-14/h3-5,7-8,15-20,22-23H,6,9-13H2,1-2H3/t15-,16+,17-,18-,19-,20+/m1/s1 |
| InChIKey | WIGHENSUPTVDNX-BGSOWLKRSA-N |
| XLogP | 1.33 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|