C18H16N2O5 — CID 11588130
7-methoxy-N-[(1R)-1-(4-nitrophenyl)ethyl]-1-benzofuran-2-carboxamide (PubChem CID 11588130) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is 7-methoxy-N-[(1R)-1-(4-nitrophenyl)ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 7-methoxy-N-[(1R)-1-(4-nitrophenyl)ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 11588130 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 7-methoxy-N-[(1R)-1-(4-nitrophenyl)ethyl]-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc2cc(C(=O)N[C@H](C)c3ccc([N+](=O)[O-])cc3)oc12 |
| InChI | InChI=1S/C18H16N2O5/c1-11(12-6-8-14(9-7-12)20(22)23)19-18(21)16-10-13-4-3-5-15(24-2)17(13)25-16/h3-11H,1-2H3,(H,19,21)/t11-/m1/s1 |
| InChIKey | VXTDKTOZFFNTQZ-LLVKDONJSA-N |
| XLogP | 3.84 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|