C24H28N2O3 — CID 125042405
7-methoxy-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]-1-benzofuran-2-carboxamide (PubChem CID 125042405) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 7-methoxy-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 7-methoxy-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 125042405 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 7-methoxy-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc2cc(C(=O)N[C@@H](C)c3ccc(N4CCC[C@H](C)C4)cc3)oc12 |
| InChI | InChI=1S/C24H28N2O3/c1-16-6-5-13-26(15-16)20-11-9-18(10-12-20)17(2)25-24(27)22-14-19-7-4-8-21(28-3)23(19)29-22/h4,7-12,14,16-17H,5-6,13,15H2,1-3H3,(H,25,27)/t16-,17-/m0/s1 |
| InChIKey | XLWIHBDLJJFABM-IRXDYDNUSA-N |
| XLogP | 5.17 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|