C12H17NO3S — CID 115882141
methyl 5-[(thian-3-ylamino)methyl]furan-2-carboxylate (PubChem CID 115882141) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is methyl 5-[(thian-3-ylamino)methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(thian-3-ylamino)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 115882141 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | methyl 5-[(thian-3-ylamino)methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CNC2CCCSC2)o1 |
| InChI | InChI=1S/C12H17NO3S/c1-15-12(14)11-5-4-10(16-11)7-13-9-3-2-6-17-8-9/h4-5,9,13H,2-3,6-8H2,1H3 |
| InChIKey | VVALYKUGPHQDMX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |