C12H16N2O4 — CID 55246254
methyl 5-[[(6-oxopiperidin-3-yl)amino]methyl]furan-2-carboxylate (PubChem CID 55246254) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl 5-[[(6-oxopiperidin-3-yl)amino]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(6-oxopiperidin-3-yl)amino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 55246254 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | methyl 5-[[(6-oxopiperidin-3-yl)amino]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CNC2CCC(=O)NC2)o1 |
| InChI | InChI=1S/C12H16N2O4/c1-17-12(16)10-4-3-9(18-10)7-13-8-2-5-11(15)14-6-8/h3-4,8,13H,2,5-7H2,1H3,(H,14,15) |
| InChIKey | JJPUBKUAYWDSAC-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |