C11H19NO2S — CID 115883078
4-[(3-methoxythiophen-2-yl)methyl-methylamino]butan-2-ol (PubChem CID 115883078) has the molecular formula C11H19NO2S and a molecular weight of 229.34 g/mol. Its IUPAC name is 4-[(3-methoxythiophen-2-yl)methyl-methylamino]butan-2-ol.
| Compound Name | 4-[(3-methoxythiophen-2-yl)methyl-methylamino]butan-2-ol |
|---|---|
| PubChem CID | 115883078 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 4-[(3-methoxythiophen-2-yl)methyl-methylamino]butan-2-ol |
| SMILES | COc1ccsc1CN(C)CCC(C)O |
| InChI | InChI=1S/C11H19NO2S/c1-9(13)4-6-12(2)8-11-10(14-3)5-7-15-11/h5,7,9,13H,4,6,8H2,1-3H3 |
| InChIKey | WVYVMZBTONGBQC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |