C16H19N5 — CID 115887018
N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-methylphthalazin-1-amine (PubChem CID 115887018) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-methylphthalazin-1-amine.
| Compound Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-methylphthalazin-1-amine |
|---|---|
| PubChem CID | 115887018 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-methylphthalazin-1-amine |
| SMILES | CCc1nn(C)cc1CNc1nnc(C)c2ccccc12 |
| InChI | InChI=1S/C16H19N5/c1-4-15-12(10-21(3)20-15)9-17-16-14-8-6-5-7-13(14)11(2)18-19-16/h5-8,10H,4,9H2,1-3H3,(H,17,19) |
| InChIKey | HPDDZICUKYHOEP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |