C15H17N5 — CID 115990483
N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]cinnolin-4-amine (PubChem CID 115990483) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]cinnolin-4-amine.
| Compound Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]cinnolin-4-amine |
|---|---|
| PubChem CID | 115990483 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]cinnolin-4-amine |
| SMILES | CCc1nn(C)cc1CNc1cnnc2ccccc12 |
| InChI | InChI=1S/C15H17N5/c1-3-13-11(10-20(2)19-13)8-16-15-9-17-18-14-7-5-4-6-12(14)15/h4-7,9-10H,3,8H2,1-2H3,(H,16,18) |
| InChIKey | ZNOHBXMEQFZHRF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |