About N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]thiolan-3-amine
N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]thiolan-3-amine (PubChem CID 115889210) has the molecular formula C9H18N2O2S2
and a molecular weight of 250.39 g/mol. Its IUPAC name is N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]thiolan-3-amine.
Molecular Properties
| Compound Name | N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]thiolan-3-amine |
| PubChem CID | 115889210 |
| Molecular Formula | C9H18N2O2S2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]thiolan-3-amine |
| SMILES | O=S1(=O)CCCN1CCNC1CCSC1 |
| InChI | InChI=1S/C9H18N2O2S2/c12-15(13)7-1-4-11(15)5-3-10-9-2-6-14-8-9/h9-10H,1-8H2 |
| InChIKey | BLQFVLSPEUHMME-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]thiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]thiolan-3-amine?
The IUPAC name of N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]thiolan-3-amine (CID 115889210) is N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]thiolan-3-amine.
What is the SMILES notation for N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]thiolan-3-amine?
The canonical SMILES for N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]thiolan-3-amine is O=S1(=O)CCCN1CCNC1CCSC1.
What is the InChIKey of N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]thiolan-3-amine?
The InChIKey is BLQFVLSPEUHMME-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2S2/c12-15(13)7-1-4-11(15)5-3-10-9-2-6-14-8-9/h9-10H,1-8H2.
What are the key properties of N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]thiolan-3-amine?
N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]thiolan-3-amine has a molecular weight of 250.39 g/mol, XLogP of 0.12, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]thiolan-3-amine is sourced from PubChem (CID 115889210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).