C14H18BrF2NO2 — CID 115889295
N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1-(oxolan-3-yl)ethanamine (PubChem CID 115889295) has the molecular formula C14H18BrF2NO2 and a molecular weight of 350.20 g/mol. Its IUPAC name is N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1-(oxolan-3-yl)ethanamine.
| Compound Name | N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1-(oxolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 115889295 |
| Molecular Formula | C14H18BrF2NO2 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1-(oxolan-3-yl)ethanamine |
| SMILES | CC(NCc1cc(Br)ccc1OC(F)F)C1CCOC1 |
| InChI | InChI=1S/C14H18BrF2NO2/c1-9(10-4-5-19-8-10)18-7-11-6-12(15)2-3-13(11)20-14(16)17/h2-3,6,9-10,14,18H,4-5,7-8H2,1H3 |
| InChIKey | ODLFAIRLZIMCBU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |