About N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]heptan-4-amine
N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]heptan-4-amine (PubChem CID 115891150) has the molecular formula C11H22N4
and a molecular weight of 210.32 g/mol. Its IUPAC name is N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]heptan-4-amine.
Molecular Properties
| Compound Name | N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]heptan-4-amine |
| PubChem CID | 115891150 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]heptan-4-amine |
| SMILES | CCCC(CCC)NCc1n[nH]c(C)n1 |
| InChI | InChI=1S/C11H22N4/c1-4-6-10(7-5-2)12-8-11-13-9(3)14-15-11/h10,12H,4-8H2,1-3H3,(H,13,14,15) |
| InChIKey | MNVHYTOCWDTYAU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]heptan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]heptan-4-amine?
The IUPAC name of N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]heptan-4-amine (CID 115891150) is N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]heptan-4-amine.
What is the SMILES notation for N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]heptan-4-amine?
The canonical SMILES for N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]heptan-4-amine is CCCC(CCC)NCc1n[nH]c(C)n1.
What is the InChIKey of N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]heptan-4-amine?
The InChIKey is MNVHYTOCWDTYAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N4/c1-4-6-10(7-5-2)12-8-11-13-9(3)14-15-11/h10,12H,4-8H2,1-3H3,(H,13,14,15).
What are the key properties of N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]heptan-4-amine?
N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]heptan-4-amine has a molecular weight of 210.32 g/mol, XLogP of 2.17, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]heptan-4-amine is sourced from PubChem (CID 115891150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).