C14H27NO — CID 115896007
N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-5-methylhexan-2-amine (PubChem CID 115896007) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-5-methylhexan-2-amine.
| Compound Name | N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-5-methylhexan-2-amine |
|---|---|
| PubChem CID | 115896007 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-5-methylhexan-2-amine |
| SMILES | CC(C)CCC(C)NCCC1=CCOCC1 |
| InChI | InChI=1S/C14H27NO/c1-12(2)4-5-13(3)15-9-6-14-7-10-16-11-8-14/h7,12-13,15H,4-6,8-11H2,1-3H3 |
| InChIKey | RCOLORWHBVSUPI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|