C8H13NO — CID 166469368
3-(3,6-dihydro-2H-pyran-4-yl)azetidine (PubChem CID 166469368) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 3-(3,6-dihydro-2H-pyran-4-yl)azetidine.
| Compound Name | 3-(3,6-dihydro-2H-pyran-4-yl)azetidine |
|---|---|
| PubChem CID | 166469368 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 3-(3,6-dihydro-2H-pyran-4-yl)azetidine |
| SMILES | C1=C(C2CNC2)CCOC1 |
| InChI | InChI=1S/C8H13NO/c1-3-10-4-2-7(1)8-5-9-6-8/h1,8-9H,2-6H2 |
| InChIKey | FBNDNLSGBHRYBK-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|