C13H25NO — CID 115896020
N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylpentan-3-amine (PubChem CID 115896020) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylpentan-3-amine.
| Compound Name | N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylpentan-3-amine |
|---|---|
| PubChem CID | 115896020 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylpentan-3-amine |
| SMILES | CCC(NCCC1=CCOCC1)C(C)C |
| InChI | InChI=1S/C13H25NO/c1-4-13(11(2)3)14-8-5-12-6-9-15-10-7-12/h6,11,13-14H,4-5,7-10H2,1-3H3 |
| InChIKey | QGULNKHPVXGLFC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|