C14H23NO — CID 115763776
N-(cyclohex-3-en-1-ylmethyl)-2-(3,6-dihydro-2H-pyran-4-yl)ethanamine (PubChem CID 115763776) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethyl)-2-(3,6-dihydro-2H-pyran-4-yl)ethanamine.
| Compound Name | N-(cyclohex-3-en-1-ylmethyl)-2-(3,6-dihydro-2H-pyran-4-yl)ethanamine |
|---|---|
| PubChem CID | 115763776 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethyl)-2-(3,6-dihydro-2H-pyran-4-yl)ethanamine |
| SMILES | C1=CCC(CNCCC2=CCOCC2)CC1 |
| InChI | InChI=1S/C14H23NO/c1-2-4-14(5-3-1)12-15-9-6-13-7-10-16-11-8-13/h1-2,7,14-15H,3-6,8-12H2 |
| InChIKey | JWXRFZQSIRPOEV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|