C14H23NO — CID 134958683
(6S,7aR)-N-cyclohexyl-1,3,5,6,7,7a-hexahydrocyclopenta[c]pyran-6-amine (PubChem CID 134958683) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is (6S,7aR)-N-cyclohexyl-1,3,5,6,7,7a-hexahydrocyclopenta[c]pyran-6-amine.
| Compound Name | (6S,7aR)-N-cyclohexyl-1,3,5,6,7,7a-hexahydrocyclopenta[c]pyran-6-amine |
|---|---|
| PubChem CID | 134958683 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (6S,7aR)-N-cyclohexyl-1,3,5,6,7,7a-hexahydrocyclopenta[c]pyran-6-amine |
| SMILES | C1=C2C[C@@H](NC3CCCCC3)C[C@H]2COC1 |
| InChI | InChI=1S/C14H23NO/c1-2-4-13(5-3-1)15-14-8-11-6-7-16-10-12(11)9-14/h6,12-15H,1-5,7-10H2/t12-,14+/m0/s1 |
| InChIKey | YWOMIASETPMEGK-GXTWGEPZSA-N |
| XLogP | 2.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|