C13H25NO — CID 163429853
(3R)-5-cyclohex-2-en-1-yloxy-N,3-dimethylpentan-1-amine (PubChem CID 163429853) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is (3R)-5-cyclohex-2-en-1-yloxy-N,3-dimethylpentan-1-amine.
| Compound Name | (3R)-5-cyclohex-2-en-1-yloxy-N,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 163429853 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (3R)-5-cyclohex-2-en-1-yloxy-N,3-dimethylpentan-1-amine |
| SMILES | CNCC[C@@H](C)CCOC1C=CCCC1 |
| InChI | InChI=1S/C13H25NO/c1-12(8-10-14-2)9-11-15-13-6-4-3-5-7-13/h4,6,12-14H,3,5,7-11H2,1-2H3/t12-,13?/m1/s1 |
| InChIKey | APODQAJYGWKBRF-PZORYLMUSA-N |
| XLogP | 2.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|