C12H23NO — CID 177319857
4-(4,6-dimethyl-2H-pyran-2-yl)-N-methylbutan-1-amine;molecular hydrogen (PubChem CID 177319857) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 4-(4,6-dimethyl-2H-pyran-2-yl)-N-methylbutan-1-amine;molecular hydrogen.
| Compound Name | 4-(4,6-dimethyl-2H-pyran-2-yl)-N-methylbutan-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 177319857 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 4-(4,6-dimethyl-2H-pyran-2-yl)-N-methylbutan-1-amine;molecular hydrogen |
| SMILES | CNCCCCC1C=C(C)C=C(C)O1.[H][H] |
| InChI | InChI=1S/C12H21NO.H2/c1-10-8-11(2)14-12(9-10)6-4-5-7-13-3;/h8-9,12-13H,4-7H2,1-3H3;1H |
| InChIKey | PCIDWNNAPCHUBF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|