About 4-[(3E,5Z)-5-methylocta-3,5-dien-4-yl]oxypiperidine
4-[(3E,5Z)-5-methylocta-3,5-dien-4-yl]oxypiperidine (PubChem CID 142944388) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is 4-[(3E,5Z)-5-methylocta-3,5-dien-4-yl]oxypiperidine.
Molecular Properties
| Compound Name | 4-[(3E,5Z)-5-methylocta-3,5-dien-4-yl]oxypiperidine |
| PubChem CID | 142944388 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 4-[(3E,5Z)-5-methylocta-3,5-dien-4-yl]oxypiperidine |
| SMILES | CC/C=C(C)\C(=C/CC)OC1CCNCC1 |
| InChI | InChI=1S/C14H25NO/c1-4-6-12(3)14(7-5-2)16-13-8-10-15-11-9-13/h6-7,13,15H,4-5,8-11H2,1-3H3/b12-6-,14-7+ |
| InChIKey | CMRHUHYAXFLVGA-GQUDHXATSA-N |
| XLogP | 3.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3E,5Z)-5-methylocta-3,5-dien-4-yl]oxypiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3E,5Z)-5-methylocta-3,5-dien-4-yl]oxypiperidine?
The IUPAC name of 4-[(3E,5Z)-5-methylocta-3,5-dien-4-yl]oxypiperidine (CID 142944388) is 4-[(3E,5Z)-5-methylocta-3,5-dien-4-yl]oxypiperidine.
What is the SMILES notation for 4-[(3E,5Z)-5-methylocta-3,5-dien-4-yl]oxypiperidine?
The canonical SMILES for 4-[(3E,5Z)-5-methylocta-3,5-dien-4-yl]oxypiperidine is CC/C=C(C)\C(=C/CC)OC1CCNCC1.
What is the InChIKey of 4-[(3E,5Z)-5-methylocta-3,5-dien-4-yl]oxypiperidine?
The InChIKey is CMRHUHYAXFLVGA-GQUDHXATSA-N. The full InChI is InChI=1S/C14H25NO/c1-4-6-12(3)14(7-5-2)16-13-8-10-15-11-9-13/h6-7,13,15H,4-5,8-11H2,1-3H3/b12-6-,14-7+.
What are the key properties of 4-[(3E,5Z)-5-methylocta-3,5-dien-4-yl]oxypiperidine?
4-[(3E,5Z)-5-methylocta-3,5-dien-4-yl]oxypiperidine has a molecular weight of 223.36 g/mol, XLogP of 3.41, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3E,5Z)-5-methylocta-3,5-dien-4-yl]oxypiperidine is sourced from PubChem (CID 142944388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).