C13H21F2NO — CID 142380154
4-cyclohexa-1,5-dien-1-yloxy-3,3-difluoropiperidine;ethane (PubChem CID 142380154) has the molecular formula C13H21F2NO and a molecular weight of 245.31 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yloxy-3,3-difluoropiperidine;ethane.
| Compound Name | 4-cyclohexa-1,5-dien-1-yloxy-3,3-difluoropiperidine;ethane |
|---|---|
| PubChem CID | 142380154 |
| Molecular Formula | C13H21F2NO |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yloxy-3,3-difluoropiperidine;ethane |
| SMILES | CC.FC1(F)CNCCC1OC1=CCCC=C1 |
| InChI | InChI=1S/C11H15F2NO.C2H6/c12-11(13)8-14-7-6-10(11)15-9-4-2-1-3-5-9;1-2/h2,4-5,10,14H,1,3,6-8H2;1-2H3 |
| InChIKey | HBEDKQQBQYHBDH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |