C11H15F2NO — CID 142380155
4-cyclohexa-1,5-dien-1-yloxy-3,3-difluoropiperidine (PubChem CID 142380155) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yloxy-3,3-difluoropiperidine.
| Compound Name | 4-cyclohexa-1,5-dien-1-yloxy-3,3-difluoropiperidine |
|---|---|
| PubChem CID | 142380155 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yloxy-3,3-difluoropiperidine |
| SMILES | FC1(F)CNCCC1OC1=CCCC=C1 |
| InChI | InChI=1S/C11H15F2NO/c12-11(13)8-14-7-6-10(11)15-9-4-2-1-3-5-9/h2,4-5,10,14H,1,3,6-8H2 |
| InChIKey | YFQLPMANPAOEFL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |