C11H17NO — CID 139334582
4-cyclohexa-2,4-dien-1-yloxypiperidine (PubChem CID 139334582) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 4-cyclohexa-2,4-dien-1-yloxypiperidine.
| Compound Name | 4-cyclohexa-2,4-dien-1-yloxypiperidine |
|---|---|
| PubChem CID | 139334582 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 4-cyclohexa-2,4-dien-1-yloxypiperidine |
| SMILES | C1=CCC(OC2CCNCC2)C=C1 |
| InChI | InChI=1S/C11H17NO/c1-2-4-10(5-3-1)13-11-6-8-12-9-7-11/h1-4,10-12H,5-9H2 |
| InChIKey | RRTQVBYPJMIQMY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |